LY-293111

LY-293111

LY-293111 is a chemical compound that has been studied for its potential therapeutic effects, particularly in the context of cancer treatment. It is known to act as a leukotriene B4 receptor antagonist and has been investigated for its ability to inhibit tumor growth and metastasis.

Chemical Structure and Properties

LY-293111 is a synthetic compound with a specific chemical structure that allows it to interact with leukotriene B4 (LTB4) receptors. The compound's molecular formula is C₃₀H₃₃NO₄, and it has a molecular weight of 471.59 g/mol. The structure of LY-293111 includes a naphthalene moiety, which is crucial for its biological activity.

Mechanism of Action

LY-293111 functions primarily as a leukotriene B4 receptor antagonist. Leukotriene B4 is a pro-inflammatory mediator that plays a role in various inflammatory diseases and cancer. By blocking the LTB4 receptor, LY-293111 can reduce inflammation and potentially inhibit cancer cell proliferation and metastasis.

Pharmacological Effects

Studies have shown that LY-293111 can inhibit the growth of certain cancer cell lines in vitro and reduce tumor growth in animal models. Its anti-inflammatory properties also make it a candidate for treating diseases characterized by excessive inflammation.

Clinical Research

Research on LY-293111 has primarily been conducted in preclinical settings. While it has shown promise in laboratory studies, further research is needed to determine its efficacy and safety in humans. Clinical trials would be necessary to establish its potential as a therapeutic agent.

Potential Applications

The primary area of interest for LY-293111 is in oncology, where it may be used to treat cancers that are driven by inflammatory processes. Additionally, its role as an anti-inflammatory agent could make it useful in treating other conditions such as asthma or arthritis.

Safety and Toxicity

As with any investigational drug, the safety and toxicity profile of LY-293111 must be thoroughly evaluated. Preclinical studies have provided some insights, but comprehensive clinical trials are required to fully understand its safety in humans.

Also see

• Leukotriene B4
• Receptor antagonist
• Cancer treatment
• Inflammation

{{Drugbox | verifiedfields = changed | verifiedrevid = 477002123 | IUPAC_name = (2S)-2-[[4-[3-(4-phenylbutoxy)phenyl]phenyl]methyl]butanoic acid | image = LY-293111_structure.png | width = 200 | CAS_number = 204205-90-3 | PubChem = 5282131 | ChemSpiderID = 4445360 | UNII = 3F0YJ6E0YQ | KEGG = D06092 | ChEMBL = 1201180 | C = 30 | H = 33 | N = 1 | O = 4 | smiles = CCC(Cc1ccc(cc1)c2cccc(c2)OCCCCc3ccccc3)C(=O)O | InChI = 1S/C30H33NO4/c1-2-26(30(32)33)22-25-15-17-27(18-16-25)28-11-9-10-12-29(28)35-21-8-7-20-24-14-6-5-13-23(24)19-4-3-19/h5-6,9-18,26H,2-4,7-8,19-22H2,1H3,(H,32,33) | InChIKey = ZQZKJXQOQWQFQH-UHFFFAOYSA-N }}